C29H32N2O3 — CID 134282541
3-[[3-[3-[3-[(3R)-3-hydroxypyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]methyl]benzonitrile (PubChem CID 134282541) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[[3-[3-[3-[(3R)-3-hydroxypyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]methyl]benzonitrile.
| Compound Name | 3-[[3-[3-[3-[(3R)-3-hydroxypyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 134282541 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-[[3-[3-[3-[(3R)-3-hydroxypyrrolidin-1-yl]propoxy]-2-methylphenyl]-2-methylphenoxy]methyl]benzonitrile |
| SMILES | Cc1c(OCCCN2CC[C@@H](O)C2)cccc1-c1cccc(OCc2cccc(C#N)c2)c1C |
| InChI | InChI=1S/C29H32N2O3/c1-21-26(9-4-11-28(21)33-16-6-14-31-15-13-25(32)19-31)27-10-5-12-29(22(27)2)34-20-24-8-3-7-23(17-24)18-30/h3-5,7-12,17,25,32H,6,13-16,19-20H2,1-2H3/t25-/m1/s1 |
| InChIKey | QIZKGCRMTFTWJX-RUZDIDTESA-N |
| XLogP | 5.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|