C32H42N2O4 — CID 134282476
1-[3-[3-[3-[3-[[(1R)-2-hydroxy-1-phenylethyl]amino]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol (PubChem CID 134282476) has the molecular formula C32H42N2O4 and a molecular weight of 518.70 g/mol. Its IUPAC name is 1-[3-[3-[3-[3-[[(1R)-2-hydroxy-1-phenylethyl]amino]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol.
| Compound Name | 1-[3-[3-[3-[3-[[(1R)-2-hydroxy-1-phenylethyl]amino]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134282476 |
| Molecular Formula | C32H42N2O4 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 1-[3-[3-[3-[3-[[(1R)-2-hydroxy-1-phenylethyl]amino]propoxy]-2-methylphenyl]-2-methylphenoxy]propyl]pyrrolidin-3-ol |
| SMILES | Cc1c(OCCCN[C@@H](CO)c2ccccc2)cccc1-c1cccc(OCCCN2CCC(O)C2)c1C |
| InChI | InChI=1S/C32H42N2O4/c1-24-28(29-13-7-15-32(25(29)2)38-21-9-18-34-19-16-27(36)22-34)12-6-14-31(24)37-20-8-17-33-30(23-35)26-10-4-3-5-11-26/h3-7,10-15,27,30,33,35-36H,8-9,16-23H2,1-2H3/t27?,30-/m0/s1 |
| InChIKey | CYNGYKDELPIQQQ-MILIPEGGSA-N |
| XLogP | 4.90 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|