C30H46N2O4 — CID 134317956
(3R)-1-[3-[2-methyl-3-[2-methyl-3-[3-[methyl(2-propoxyethyl)amino]propoxy]phenyl]phenoxy]propyl]pyrrolidin-3-ol (PubChem CID 134317956) has the molecular formula C30H46N2O4 and a molecular weight of 498.71 g/mol. Its IUPAC name is (3R)-1-[3-[2-methyl-3-[2-methyl-3-[3-[methyl(2-propoxyethyl)amino]propoxy]phenyl]phenoxy]propyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-[2-methyl-3-[2-methyl-3-[3-[methyl(2-propoxyethyl)amino]propoxy]phenyl]phenoxy]propyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134317956 |
| Molecular Formula | C30H46N2O4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | (3R)-1-[3-[2-methyl-3-[2-methyl-3-[3-[methyl(2-propoxyethyl)amino]propoxy]phenyl]phenoxy]propyl]pyrrolidin-3-ol |
| SMILES | CCCOCCN(C)CCCOc1cccc(-c2cccc(OCCCN3CC[C@@H](O)C3)c2C)c1C |
| InChI | InChI=1S/C30H46N2O4/c1-5-19-34-22-18-31(4)15-8-20-35-29-12-6-10-27(24(29)2)28-11-7-13-30(25(28)3)36-21-9-16-32-17-14-26(33)23-32/h6-7,10-13,26,33H,5,8-9,14-23H2,1-4H3/t26-/m1/s1 |
| InChIKey | BCSQSGDSKXNKSV-AREMUKBSSA-N |
| XLogP | 4.93 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|