C24H33ClN2O4 — CID 45265298
(3R)-1-[2-[2-[2-(N-phenylanilino)ethoxy]ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride (PubChem CID 45265298) has the molecular formula C24H33ClN2O4 and a molecular weight of 448.99 g/mol. Its IUPAC name is (3R)-1-[2-[2-[2-(N-phenylanilino)ethoxy]ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-1-[2-[2-[2-(N-phenylanilino)ethoxy]ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 45265298 |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (3R)-1-[2-[2-[2-(N-phenylanilino)ethoxy]ethoxy]ethyl]piperidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CCCN(CCOCCOCCN(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N2O4.ClH/c27-24(28)21-8-7-13-25(20-21)14-16-29-18-19-30-17-15-26(22-9-3-1-4-10-22)23-11-5-2-6-12-23;/h1-6,9-12,21H,7-8,13-20H2,(H,27,28);1H/t21-;/m1./s1 |
| InChIKey | SERRFKSZWGZBBF-ZMBIFBSDSA-N |
| XLogP | 4.08 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|