C23H28N2O4 — CID 54034569
(3R)-1-[2-[[(3-methoxyphenyl)-(2-methylphenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 54034569) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3R)-1-[2-[[(3-methoxyphenyl)-(2-methylphenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[[(3-methoxyphenyl)-(2-methylphenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54034569 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3R)-1-[2-[[(3-methoxyphenyl)-(2-methylphenyl)methylidene]amino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | COc1cccc(C(=NOCCN2CCC[C@@H](C(=O)O)C2)c2ccccc2C)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-17-7-3-4-11-21(17)22(18-8-5-10-20(15-18)28-2)24-29-14-13-25-12-6-9-19(16-25)23(26)27/h3-5,7-8,10-11,15,19H,6,9,12-14,16H2,1-2H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | LHZLEBHZVKIEHT-LJQANCHMSA-N |
| XLogP | 3.57 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|