C23H32N2O3S2 — CID 10838603
ethyl (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylate (PubChem CID 10838603) has the molecular formula C23H32N2O3S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10838603 |
| Molecular Formula | C23H32N2O3S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | ethyl (3R)-1-[2-[bis(3-ethylthiophen-2-yl)methylideneamino]oxyethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCON=C(c2sccc2CC)c2sccc2CC)C1 |
| InChI | InChI=1S/C23H32N2O3S2/c1-4-17-9-14-29-21(17)20(22-18(5-2)10-15-30-22)24-28-13-12-25-11-7-8-19(16-25)23(26)27-6-3/h9-10,14-15,19H,4-8,11-13,16H2,1-3H3/t19-/m1/s1 |
| InChIKey | XUXOCRQCYLDQGU-LJQANCHMSA-N |
| XLogP | 4.98 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|