C22H29NO3S2 — CID 10598185
ethyl (3R)-1-[2-[2,2-bis(3-methylthiophen-2-yl)ethenoxy]ethyl]piperidine-3-carboxylate (PubChem CID 10598185) has the molecular formula C22H29NO3S2 and a molecular weight of 419.61 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2,2-bis(3-methylthiophen-2-yl)ethenoxy]ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[2,2-bis(3-methylthiophen-2-yl)ethenoxy]ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10598185 |
| Molecular Formula | C22H29NO3S2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | ethyl (3R)-1-[2-[2,2-bis(3-methylthiophen-2-yl)ethenoxy]ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCOC=C(c2sccc2C)c2sccc2C)C1 |
| InChI | InChI=1S/C22H29NO3S2/c1-4-26-22(24)18-6-5-9-23(14-18)10-11-25-15-19(20-16(2)7-12-27-20)21-17(3)8-13-28-21/h7-8,12-13,15,18H,4-6,9-11,14H2,1-3H3/t18-/m1/s1 |
| InChIKey | JAEQGPUSRTXAJP-GOSISDBHSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|