C19H28ClNO4 — CID 6460264
ethyl 1-[2-(4-prop-2-enoxyphenoxy)ethyl]piperidine-3-carboxylate;hydrochloride (PubChem CID 6460264) has the molecular formula C19H28ClNO4 and a molecular weight of 369.89 g/mol. Its IUPAC name is ethyl 1-[2-(4-prop-2-enoxyphenoxy)ethyl]piperidine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[2-(4-prop-2-enoxyphenoxy)ethyl]piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 6460264 |
| Molecular Formula | C19H28ClNO4 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | ethyl 1-[2-(4-prop-2-enoxyphenoxy)ethyl]piperidine-3-carboxylate;hydrochloride |
| SMILES | C=CCOc1ccc(OCCN2CCCC(C(=O)OCC)C2)cc1.Cl |
| InChI | InChI=1S/C19H27NO4.ClH/c1-3-13-23-17-7-9-18(10-8-17)24-14-12-20-11-5-6-16(15-20)19(21)22-4-2;/h3,7-10,16H,1,4-6,11-15H2,2H3;1H |
| InChIKey | OYYAEJNAFSQHOE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|