C24H29NO6S2 — CID 71664141
(3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid;(E)-but-2-enedioic acid (PubChem CID 71664141) has the molecular formula C24H29NO6S2 and a molecular weight of 491.63 g/mol. Its IUPAC name is (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid;(E)-but-2-enedioic acid.
| Compound Name | (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 71664141 |
| Molecular Formula | C24H29NO6S2 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (3R)-1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine-3-carboxylic acid;(E)-but-2-enedioic acid |
| SMILES | Cc1ccsc1C(=CCCN1CCC[C@@H](C(=O)O)C1)c1sccc1C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H25NO2S2.C4H4O4/c1-14-7-11-24-18(14)17(19-15(2)8-12-25-19)6-4-10-21-9-3-5-16(13-21)20(22)23;5-3(6)1-2-4(7)8/h6-8,11-12,16H,3-5,9-10,13H2,1-2H3,(H,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m1./s1 |
| InChIKey | IHCHEYUOANVMMB-RWKFXIDCSA-N |
| XLogP | 4.76 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|