C19H25NS2 — CID 143629002
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine (PubChem CID 143629002) has the molecular formula C19H25NS2 and a molecular weight of 331.55 g/mol. Its IUPAC name is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine.
| Compound Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine |
|---|---|
| PubChem CID | 143629002 |
| Molecular Formula | C19H25NS2 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperidine |
| SMILES | Cc1ccsc1C(=CCCN1CCCCC1)c1sccc1C |
| InChI | InChI=1S/C19H25NS2/c1-15-8-13-21-18(15)17(19-16(2)9-14-22-19)7-6-12-20-10-4-3-5-11-20/h7-9,13-14H,3-6,10-12H2,1-2H3 |
| InChIKey | YYQWXJDHMZUALE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |