C20H25NO2S2 — CID 162641304
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxylic acid (PubChem CID 162641304) has the molecular formula C20H25NO2S2 and a molecular weight of 384.61 g/mol. Its IUPAC name is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxylic acid.
| Compound Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 162641304 |
| Molecular Formula | C20H25NO2S2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxylic acid |
| SMILES | [2H]C1([2H])N(CCC=C(c2sccc2C)c2sccc2C)C([2H])([2H])C([2H])([2H])C([2H])(C(=O)O)C1([2H])[2H] |
| InChI | InChI=1S/C20H25NO2S2/c1-14-7-12-24-18(14)17(19-15(2)8-13-25-19)4-3-9-21-10-5-16(6-11-21)20(22)23/h4,7-8,12-13,16H,3,5-6,9-11H2,1-2H3,(H,22,23)/i5D2,6D2,10D2,11D2,16D |
| InChIKey | WDDATNYDSPRKBG-BRFHZCMKSA-N |
| XLogP | 5.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |