C19H24N2O2S2 — CID 118729895
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperazine-2-carboxylic acid (PubChem CID 118729895) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperazine-2-carboxylic acid.
| Compound Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 118729895 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]piperazine-2-carboxylic acid |
| SMILES | Cc1ccsc1C(=CCCN1CCNCC1C(=O)O)c1sccc1C |
| InChI | InChI=1S/C19H24N2O2S2/c1-13-5-10-24-17(13)15(18-14(2)6-11-25-18)4-3-8-21-9-7-20-12-16(21)19(22)23/h4-6,10-11,16,20H,3,7-9,12H2,1-2H3,(H,22,23) |
| InChIKey | ZGMNFKQJJZOIMH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |