C21H28NO2S2+ — CID 21299441
1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-1-methylpiperidin-1-ium-3-carboxylic acid (PubChem CID 21299441) has the molecular formula C21H28NO2S2+ and a molecular weight of 390.59 g/mol. Its IUPAC name is 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-1-methylpiperidin-1-ium-3-carboxylic acid.
| Compound Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-1-methylpiperidin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 21299441 |
| Molecular Formula | C21H28NO2S2+ |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[4,4-bis(3-methylthiophen-2-yl)but-3-enyl]-1-methylpiperidin-1-ium-3-carboxylic acid |
| SMILES | Cc1ccsc1C(=CCC[N+]1(C)CCCC(C(=O)O)C1)c1sccc1C |
| InChI | InChI=1S/C21H27NO2S2/c1-15-8-12-25-19(15)18(20-16(2)9-13-26-20)7-5-11-22(3)10-4-6-17(14-22)21(23)24/h7-9,12-13,17H,4-6,10-11,14H2,1-3H3/p+1 |
| InChIKey | ZVROLKWECXRXQJ-UHFFFAOYSA-O |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|