C19H28N2O3 — CID 57050550
1-[2-[(3-methyl-1-phenylbut-1-enyl)amino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 57050550) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[2-[(3-methyl-1-phenylbut-1-enyl)amino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(3-methyl-1-phenylbut-1-enyl)amino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57050550 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[2-[(3-methyl-1-phenylbut-1-enyl)amino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)C=C(NOCCN1CCCC(C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O3/c1-15(2)13-18(16-7-4-3-5-8-16)20-24-12-11-21-10-6-9-17(14-21)19(22)23/h3-5,7-8,13,15,17,20H,6,9-12,14H2,1-2H3,(H,22,23) |
| InChIKey | PYVATRGWFQHSMK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|