C23H24N2O3 — CID 155524811
1-[2-[(E)-phenanthren-9-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 155524811) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[2-[(E)-phenanthren-9-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(E)-phenanthren-9-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155524811 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[2-[(E)-phenanthren-9-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCO/N=C/c2cc3ccccc3c3ccccc23)C1 |
| InChI | InChI=1S/C23H24N2O3/c26-23(27)18-7-5-11-25(16-18)12-13-28-24-15-19-14-17-6-1-2-8-20(17)22-10-4-3-9-21(19)22/h1-4,6,8-10,14-15,18H,5,7,11-13,16H2,(H,26,27)/b24-15+ |
| InChIKey | AEZYYBLWAOMYQF-BUVRLJJBSA-N |
| XLogP | 4.14 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|