C26H26N2O3 — CID 155560134
1-[2-[(E)-[2-(3-phenylphenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid (PubChem CID 155560134) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-[2-[(E)-[2-(3-phenylphenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(E)-[2-(3-phenylphenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155560134 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[2-[(E)-[2-(3-phenylphenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(CCO/N=C/c2ccccc2-c2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C26H26N2O3/c29-26(30)24-13-14-28(19-24)15-16-31-27-18-23-9-4-5-12-25(23)22-11-6-10-21(17-22)20-7-2-1-3-8-20/h1-12,17-18,24H,13-16,19H2,(H,29,30)/b27-18+ |
| InChIKey | ZHPXOAFYFBISKF-OVVQPSECSA-N |
| XLogP | 4.78 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|