C20H21Cl2FN2O3 — CID 155549568
1-[2-[(E)-[2-(2-chloro-4-fluorophenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 155549568) has the molecular formula C20H21Cl2FN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is 1-[2-[(E)-[2-(2-chloro-4-fluorophenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[(E)-[2-(2-chloro-4-fluorophenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 155549568 |
| Molecular Formula | C20H21Cl2FN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[2-[(E)-[2-(2-chloro-4-fluorophenyl)phenyl]methylideneamino]oxyethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(CCO/N=C/c2ccccc2-c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C20H20ClFN2O3.ClH/c21-19-11-16(22)5-6-18(19)17-4-2-1-3-14(17)12-23-27-10-9-24-8-7-15(13-24)20(25)26;/h1-6,11-12,15H,7-10,13H2,(H,25,26);1H/b23-12+; |
| InChIKey | ITAROYDDSYQUPB-RRHSQXQGSA-N |
| XLogP | 4.32 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|