C19H24N4O3 — CID 173282678
1-[2-[[2-(1-methylimidazol-2-yl)phenyl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 173282678) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[2-[[2-(1-methylimidazol-2-yl)phenyl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[[2-(1-methylimidazol-2-yl)phenyl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 173282678 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[2-[[2-(1-methylimidazol-2-yl)phenyl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | Cn1ccnc1-c1ccccc1C=NOCCN1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C19H24N4O3/c1-22-10-8-20-18(22)17-7-3-2-5-15(17)13-21-26-12-11-23-9-4-6-16(14-23)19(24)25/h2-3,5,7-8,10,13,16H,4,6,9,11-12,14H2,1H3,(H,24,25) |
| InChIKey | YUGRFCHDDAKQEF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|