C18H21N3O3 — CID 155531905
1-[2-[(E)-quinolin-4-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 155531905) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[2-[(E)-quinolin-4-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(E)-quinolin-4-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155531905 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[2-[(E)-quinolin-4-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCO/N=C/c2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C18H21N3O3/c22-18(23)15-4-3-9-21(13-15)10-11-24-20-12-14-7-8-19-17-6-2-1-5-16(14)17/h1-2,5-8,12,15H,3-4,9-11,13H2,(H,22,23)/b20-12+ |
| InChIKey | FOTJDUOZGJMMPX-UDWIEESQSA-N |
| XLogP | 2.38 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|