C20H20ClF3N2O4 — CID 155526834
1-[2-[(E)-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 155526834) has the molecular formula C20H20ClF3N2O4 and a molecular weight of 444.84 g/mol. Its IUPAC name is 1-[2-[(E)-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(E)-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155526834 |
| Molecular Formula | C20H20ClF3N2O4 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-[2-[(E)-[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCO/N=C/c2ccc(-c3ccc(C(F)(F)F)cc3Cl)o2)C1 |
| InChI | InChI=1S/C20H20ClF3N2O4/c21-17-10-14(20(22,23)24)3-5-16(17)18-6-4-15(30-18)11-25-29-9-8-26-7-1-2-13(12-26)19(27)28/h3-6,10-11,13H,1-2,7-9,12H2,(H,27,28)/b25-11+ |
| InChIKey | YBXTVILBSFOYAQ-OPEKNORGSA-N |
| XLogP | 4.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|