C22H34N2O3 — CID 57226280
1-[2-(1-phenyloct-1-enylamino)oxyethyl]piperidine-3-carboxylic acid (PubChem CID 57226280) has the molecular formula C22H34N2O3 and a molecular weight of 374.52 g/mol. Its IUPAC name is 1-[2-(1-phenyloct-1-enylamino)oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(1-phenyloct-1-enylamino)oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57226280 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[2-(1-phenyloct-1-enylamino)oxyethyl]piperidine-3-carboxylic acid |
| SMILES | CCCCCCC=C(NOCCN1CCCC(C(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C22H34N2O3/c1-2-3-4-5-9-14-21(19-11-7-6-8-12-19)23-27-17-16-24-15-10-13-20(18-24)22(25)26/h6-8,11-12,14,20,23H,2-5,9-10,13,15-18H2,1H3,(H,25,26) |
| InChIKey | CBQXEDIPPIJGDJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|