C24H26ClF4NO3 — CID 10767315
ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidin-1-ium-3-carboxylate chloride (PubChem CID 10767315) has the molecular formula C24H26ClF4NO3 and a molecular weight of 487.92 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidin-1-ium-3-carboxylate chloride.
| Compound Name | ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidin-1-ium-3-carboxylate chloride |
|---|---|
| PubChem CID | 10767315 |
| Molecular Formula | C24H26ClF4NO3 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | ethyl (3R)-1-[2-[2,2-bis(2,5-difluorophenyl)ethenoxy]ethyl]piperidin-1-ium-3-carboxylate chloride |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](CCOC=C(c2cc(F)ccc2F)c2cc(F)ccc2F)C1.[Cl-] |
| InChI | InChI=1S/C24H25F4NO3.ClH/c1-2-32-24(30)16-4-3-9-29(14-16)10-11-31-15-21(19-12-17(25)5-7-22(19)27)20-13-18(26)6-8-23(20)28;/h5-8,12-13,15-16H,2-4,9-11,14H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | IDZJFRHOIBLZGR-PKLMIRHRSA-N |
| XLogP | 0.51 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|