About 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate
1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate (PubChem CID 9478017) has the molecular formula C20H26N2O8
and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate |
| PubChem CID | 9478017 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)C1 |
| InChI | InChI=1S/C20H26N2O8/c1-20(2,3)30-19(24)21-6-4-5-13(9-21)18(23)28-11-15-8-16(22(25)26)7-14-10-27-12-29-17(14)15/h7-8,13H,4-6,9-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | JVFPYVVKSKPXDQ-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate (CID 9478017) is 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate is CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)C1.
What is the InChIKey of 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate?
The InChIKey is JVFPYVVKSKPXDQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C20H26N2O8/c1-20(2,3)30-19(24)21-6-4-5-13(9-21)18(23)28-11-15-8-16(22(25)26)7-14-10-27-12-29-17(14)15/h7-8,13H,4-6,9-12H2,1-3H3/t13-/m1/s1.
What are the key properties of 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate?
1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate has a molecular weight of 422.43 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate is sourced from PubChem (CID 9478017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).