C20H26N2O8 — CID 9478017
1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate (PubChem CID 9478017) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9478017 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl] (3R)-piperidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)C1 |
| InChI | InChI=1S/C20H26N2O8/c1-20(2,3)30-19(24)21-6-4-5-13(9-21)18(23)28-11-15-8-16(22(25)26)7-14-10-27-12-29-17(14)15/h7-8,13H,4-6,9-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | JVFPYVVKSKPXDQ-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|