C23H27N3O5 — CID 86906152
2-[4-methyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]anilino]-1-piperidin-1-ylethanone (PubChem CID 86906152) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[4-methyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]anilino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-methyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]anilino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 86906152 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[4-methyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]anilino]-1-piperidin-1-ylethanone |
| SMILES | Cc1ccc(N(CC(=O)N2CCCCC2)Cc2cc([N+](=O)[O-])cc3c2OCOC3)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-17-5-7-20(8-6-17)25(14-22(27)24-9-3-2-4-10-24)13-18-11-21(26(28)29)12-19-15-30-16-31-23(18)19/h5-8,11-12H,2-4,9-10,13-16H2,1H3 |
| InChIKey | WFDAIKFFVVELPL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|