C19H18N2O7S — CID 2122720
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 2122720) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2122720 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)[C@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C19H18N2O7S/c22-18(16-4-2-6-29-16)20-5-1-3-15(20)19(23)27-10-13-8-14(21(24)25)7-12-9-26-11-28-17(12)13/h2,4,6-8,15H,1,3,5,9-11H2/t15-/m1/s1 |
| InChIKey | BDOGOOHUUNZKQI-OAHLLOKOSA-N |
| XLogP | 2.87 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|