C18H16BrN3O6S — CID 23880961
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 23880961) has the molecular formula C18H16BrN3O6S and a molecular weight of 482.31 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23880961 |
| Molecular Formula | C18H16BrN3O6S |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN1C(=O)c1cccs1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H16BrN3O6S/c19-12-9-11(22(26)27)5-6-13(12)20-16(23)10-28-18(25)14-3-1-7-21(14)17(24)15-4-2-8-29-15/h2,4-6,8-9,14H,1,3,7,10H2,(H,20,23) |
| InChIKey | RHEQAQQNWJKSFC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|