C20H21N3O7S — CID 27542012
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate (PubChem CID 27542012) has the molecular formula C20H21N3O7S and a molecular weight of 447.47 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 27542012 |
| Molecular Formula | C20H21N3O7S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H21N3O7S/c1-29-16-11-14(23(27)28)4-5-15(16)21-18(24)12-30-20(26)13-6-8-22(9-7-13)19(25)17-3-2-10-31-17/h2-5,10-11,13H,6-9,12H2,1H3,(H,21,24) |
| InChIKey | XSDIAZGFRNSTDV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|