C19H22N2O7 — CID 7187264
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 7187264) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 7187264 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)C1C[C@H]2CCC[C@@H](C1)C2=O |
| InChI | InChI=1S/C19H22N2O7/c1-27-16-9-14(21(25)26)5-6-15(16)20-17(22)10-28-19(24)13-7-11-3-2-4-12(8-13)18(11)23/h5-6,9,11-13H,2-4,7-8,10H2,1H3,(H,20,22)/t11-,12+,13? |
| InChIKey | JZPYUIWXJZXMJS-FUNVUKJBSA-N |
| XLogP | 2.48 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|