C20H20N4O7 — CID 42316196
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 3-(3-methyl-2-oxobenzimidazol-1-yl)propanoate (PubChem CID 42316196) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 3-(3-methyl-2-oxobenzimidazol-1-yl)propanoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 3-(3-methyl-2-oxobenzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 42316196 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 3-(3-methyl-2-oxobenzimidazol-1-yl)propanoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CCn1c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O7/c1-22-15-5-3-4-6-16(15)23(20(22)27)10-9-19(26)31-12-18(25)21-14-8-7-13(24(28)29)11-17(14)30-2/h3-8,11H,9-10,12H2,1-2H3,(H,21,25) |
| InChIKey | VOVYZQJKJNWTRB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|