C17H16ClN3O4S — CID 17224082
N-(2-chloro-5-nitrophenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 17224082) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17224082 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H16ClN3O4S/c18-13-4-3-12(21(24)25)10-14(13)19-16(22)11-5-7-20(8-6-11)17(23)15-2-1-9-26-15/h1-4,9-11H,5-8H2,(H,19,22) |
| InChIKey | LHWKELRJWOYVDX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|