C20H22N2O4S — CID 51504438
[2-(3-ethylanilino)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 51504438) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 51504438 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] (2S)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CCc1cccc(NC(=O)COC(=O)[C@@H]2CCCN2C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-2-14-6-3-7-15(12-14)21-18(23)13-26-20(25)16-8-4-10-22(16)19(24)17-9-5-11-27-17/h3,5-7,9,11-12,16H,2,4,8,10,13H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | NEYFJJDEUXWPRI-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |