C20H20N2O8S — CID 2640669
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2640669) has the molecular formula C20H20N2O8S and a molecular weight of 448.45 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2640669 |
| Molecular Formula | C20H20N2O8S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H20N2O8S/c23-20(14-4-3-5-18(10-14)31(26,27)21-6-1-2-7-21)29-12-16-9-17(22(24)25)8-15-11-28-13-30-19(15)16/h3-5,8-10H,1-2,6-7,11-13H2 |
| InChIKey | SAZUTXXHKZTOQJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|