C23H21N3O7 — CID 2647093
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxylate (PubChem CID 2647093) has the molecular formula C23H21N3O7 and a molecular weight of 451.44 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 2647093 |
| Molecular Formula | C23H21N3O7 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 12-oxo-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazoline-3-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1ccc2c(=O)n3c(nc2c1)CCCCC3 |
| InChI | InChI=1S/C23H21N3O7/c27-22-18-6-5-14(10-19(18)24-20-4-2-1-3-7-25(20)22)23(28)32-12-16-9-17(26(29)30)8-15-11-31-13-33-21(15)16/h5-6,8-10H,1-4,7,11-13H2 |
| InChIKey | GZJRRVQMERAIMI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|