C23H16N2O7 — CID 18199777
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyl-2,1-benzoxazole-5-carboxylate (PubChem CID 18199777) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyl-2,1-benzoxazole-5-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyl-2,1-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 18199777 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-phenyl-2,1-benzoxazole-5-carboxylate |
| SMILES | O=C(OCc1cc([N+](=O)[O-])cc2c1OCOC2)c1ccc2noc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H16N2O7/c26-23(30-12-17-9-18(25(27)28)8-16-11-29-13-31-21(16)17)15-6-7-20-19(10-15)22(32-24-20)14-4-2-1-3-5-14/h1-10H,11-13H2 |
| InChIKey | JXFCBNWLRRBIFC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|