C27H28N2O6 — CID 2402243
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 2402243) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 2402243 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (2R)-2-tert-butyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC(C)(C)[C@@H]1CCc2nc3ccccc3c(C(=O)OCc3cc([N+](=O)[O-])cc4c3OCOC4)c2C1 |
| InChI | InChI=1S/C27H28N2O6/c1-27(2,3)18-8-9-23-21(12-18)24(20-6-4-5-7-22(20)28-23)26(30)34-14-17-11-19(29(31)32)10-16-13-33-15-35-25(16)17/h4-7,10-11,18H,8-9,12-15H2,1-3H3/t18-/m1/s1 |
| InChIKey | NXCFRBFSODQAFN-GOSISDBHSA-N |
| XLogP | 5.52 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|