C17H14N2O8S — CID 27004741
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 5-methylsulfanyl-2-nitrobenzoate (PubChem CID 27004741) has the molecular formula C17H14N2O8S and a molecular weight of 406.37 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 5-methylsulfanyl-2-nitrobenzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 5-methylsulfanyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 27004741 |
| Molecular Formula | C17H14N2O8S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 5-methylsulfanyl-2-nitrobenzoate |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)c1 |
| InChI | InChI=1S/C17H14N2O8S/c1-28-13-2-3-15(19(23)24)14(6-13)17(20)26-8-11-5-12(18(21)22)4-10-7-25-9-27-16(10)11/h2-6H,7-9H2,1H3 |
| InChIKey | MMVFHAYYZBZBDO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|