C22H24F3N3O4 — CID 24618047
1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepane (PubChem CID 24618047) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 24618047 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1cc2c(c(CN3CCCN(Cc4ccc(C(F)(F)F)cc4)CC3)c1)OCOC2 |
| InChI | InChI=1S/C22H24F3N3O4/c23-22(24,25)19-4-2-16(3-5-19)12-26-6-1-7-27(9-8-26)13-17-10-20(28(29)30)11-18-14-31-15-32-21(17)18/h2-5,10-11H,1,6-9,12-15H2 |
| InChIKey | NRODOJZZNKKETE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|