C21H24N2O9S — CID 55324406
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55324406) has the molecular formula C21H24N2O9S and a molecular weight of 480.50 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55324406 |
| Molecular Formula | C21H24N2O9S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)NC(C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)C(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O9S/c1-13(2)19(22-33(27,28)18-6-4-17(29-3)5-7-18)21(24)31-11-15-9-16(23(25)26)8-14-10-30-12-32-20(14)15/h4-9,13,19,22H,10-12H2,1-3H3 |
| InChIKey | SBAJCPWIUQXLJD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|