C24H22N2O7S — CID 4780611
N-(4-methoxyphenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-2-phenylethenesulfonamide (PubChem CID 4780611) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-2-phenylethenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 4780611 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-2-phenylethenesulfonamide |
| SMILES | COc1ccc(N(Cc2cc([N+](=O)[O-])cc3c2OCOC3)S(=O)(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O7S/c1-31-23-9-7-21(8-10-23)25(34(29,30)12-11-18-5-3-2-4-6-18)15-19-13-22(26(27)28)14-20-16-32-17-33-24(19)20/h2-14H,15-17H2,1H3 |
| InChIKey | SHVNMCONBGFBTL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|