C22H19FN2O6S — CID 2695394
N-benzyl-2-fluoro-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]benzenesulfonamide (PubChem CID 2695394) has the molecular formula C22H19FN2O6S and a molecular weight of 458.47 g/mol. Its IUPAC name is N-benzyl-2-fluoro-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-2-fluoro-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2695394 |
| Molecular Formula | C22H19FN2O6S |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-benzyl-2-fluoro-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc2c(c(CN(Cc3ccccc3)S(=O)(=O)c3ccccc3F)c1)OCOC2 |
| InChI | InChI=1S/C22H19FN2O6S/c23-20-8-4-5-9-21(20)32(28,29)24(12-16-6-2-1-3-7-16)13-17-10-19(25(26)27)11-18-14-30-15-31-22(17)18/h1-11H,12-15H2 |
| InChIKey | DUMGYPUTEMCZPU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|