C23H19F3N2O6S — CID 2454851
N-benzyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 2454851) has the molecular formula C23H19F3N2O6S and a molecular weight of 508.47 g/mol. Its IUPAC name is N-benzyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2454851 |
| Molecular Formula | C23H19F3N2O6S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | N-benzyl-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc2c(c(CN(Cc3ccccc3)S(=O)(=O)c3cccc(C(F)(F)F)c3)c1)OCOC2 |
| InChI | InChI=1S/C23H19F3N2O6S/c24-23(25,26)19-7-4-8-21(11-19)35(31,32)27(12-16-5-2-1-3-6-16)13-17-9-20(28(29)30)10-18-14-33-15-34-22(17)18/h1-11H,12-15H2 |
| InChIKey | PRUCLAQDOOYFAM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|