C24H27NO7S — CID 55928619
(6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55928619) has the molecular formula C24H27NO7S and a molecular weight of 473.55 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55928619 |
| Molecular Formula | C24H27NO7S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)C(C)C)cc1 |
| InChI | InChI=1S/C24H27NO7S/c1-14(2)23(25-33(28,29)19-8-6-18(30-5)7-9-19)24(27)31-13-17-12-22(26)32-21-11-16(4)15(3)10-20(17)21/h6-12,14,23,25H,13H2,1-5H3/t23-/m0/s1 |
| InChIKey | ADTSYJQMHGLJHB-QHCPKHFHSA-N |
| XLogP | 3.46 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|