C22H21ClN2O7S — CID 4844947
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(4-acetamidophenyl)sulfonylamino]propanoate (PubChem CID 4844947) has the molecular formula C22H21ClN2O7S and a molecular weight of 492.94 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(4-acetamidophenyl)sulfonylamino]propanoate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(4-acetamidophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 4844947 |
| Molecular Formula | C22H21ClN2O7S |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(4-acetamidophenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC(C)C(=O)OCc2cc(=O)oc3cc(C)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C22H21ClN2O7S/c1-12-8-20-18(10-19(12)23)15(9-21(27)32-20)11-31-22(28)13(2)25-33(29,30)17-6-4-16(5-7-17)24-14(3)26/h4-10,13,25H,11H2,1-3H3,(H,24,26) |
| InChIKey | DIPGAHSEAISZOU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|