C17H19ClN2O5S — CID 8579962
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 8579962) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8579962 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)OCc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C17H19ClN2O5S/c1-9-5-14-11(7-12(9)18)10(6-15(21)25-14)8-24-16(22)13(3-4-26-2)20-17(19)23/h5-7,13H,3-4,8H2,1-2H3,(H3,19,20,23)/t13-/m0/s1 |
| InChIKey | ATQXTJPTOJCRFU-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|