C27H31NO5S — CID 4001367
(7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 4001367) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 4001367 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCc1cc(=O)oc2cc(C)ccc12 |
| InChI | InChI=1S/C27H31NO5S/c1-17-6-11-21-19(15-24(29)33-23(21)14-17)16-32-26(31)22(12-13-34-5)28-25(30)18-7-9-20(10-8-18)27(2,3)4/h6-11,14-15,22H,12-13,16H2,1-5H3,(H,28,30) |
| InChIKey | QHGOXTPMQBGVEA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|