C26H22Cl2N2O10S2 — CID 89151804
(7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(chloroamino)-3-[[(2R)-2-(chloroamino)-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate (PubChem CID 89151804) has the molecular formula C26H22Cl2N2O10S2 and a molecular weight of 657.51 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(chloroamino)-3-[[(2R)-2-(chloroamino)-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(chloroamino)-3-[[(2R)-2-(chloroamino)-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 89151804 |
| Molecular Formula | C26H22Cl2N2O10S2 |
| Molecular Weight | 657.51 g/mol |
| Exact Mass | 656.01 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(chloroamino)-3-[[(2R)-2-(chloroamino)-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate |
| SMILES | O=C(OCc1cc(=O)oc2cc(O)ccc12)[C@H](CSSC[C@H](NCl)C(=O)OCc1cc(=O)oc2cc(O)ccc12)NCl |
| InChI | InChI=1S/C26H22Cl2N2O10S2/c27-29-19(25(35)37-9-13-5-23(33)39-21-7-15(31)1-3-17(13)21)11-41-42-12-20(30-28)26(36)38-10-14-6-24(34)40-22-8-16(32)2-4-18(14)22/h1-8,19-20,29-32H,9-12H2/t19-,20-/m0/s1 |
| InChIKey | YLHUXZRMGZRMFT-PMACEKPBSA-N |
| XLogP | 3.70 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|