C24H25NO6 — CID 8882489
(7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 8882489) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8882489 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C24H25NO6/c1-14(25-22(28)15-5-7-17(8-6-15)24(2,3)4)23(29)30-13-16-11-21(27)31-20-12-18(26)9-10-19(16)20/h5-12,14,26H,13H2,1-4H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | IHDGOILZRIJITE-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|