C24H24BrNO5 — CID 30421508
(7-bromo-2-oxochromen-4-yl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 30421508) has the molecular formula C24H24BrNO5 and a molecular weight of 486.36 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30421508 |
| Molecular Formula | C24H24BrNO5 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 3-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)OCc2cc(=O)oc3cc(Br)ccc23)cc1 |
| InChI | InChI=1S/C24H24BrNO5/c1-24(2,3)17-6-4-15(5-7-17)23(29)26-11-10-21(27)30-14-16-12-22(28)31-20-13-18(25)8-9-19(16)20/h4-9,12-13H,10-11,14H2,1-3H3,(H,26,29) |
| InChIKey | GPSOQPOKDCYNLS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|