C21H17BrClNO5 — CID 30398870
(7-bromo-2-oxochromen-4-yl)methyl 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 30398870) has the molecular formula C21H17BrClNO5 and a molecular weight of 478.73 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 30398870 |
| Molecular Formula | C21H17BrClNO5 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)OCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C21H17BrClNO5/c22-15-5-8-17-14(10-20(26)29-18(17)11-15)12-28-19(25)2-1-9-24-21(27)13-3-6-16(23)7-4-13/h3-8,10-11H,1-2,9,12H2,(H,24,27) |
| InChIKey | KZTXDJPHXYJBAN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|