C20H17BrClNO7S — CID 2536826
(7-bromo-2-oxochromen-4-yl)methyl (2R,3R)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate (PubChem CID 2536826) has the molecular formula C20H17BrClNO7S and a molecular weight of 530.78 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl (2R,3R)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl (2R,3R)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 2536826 |
| Molecular Formula | C20H17BrClNO7S |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl (2R,3R)-2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C20H17BrClNO7S/c1-11(24)19(23-31(27,28)15-5-3-14(22)4-6-15)20(26)29-10-12-8-18(25)30-17-9-13(21)2-7-16(12)17/h2-9,11,19,23-24H,10H2,1H3/t11-,19-/m1/s1 |
| InChIKey | IZXOHXMVHFNTAD-NSPYISDASA-N |
| XLogP | 2.98 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|